N-Fmoc-5-fluoro-L-tryptophan
N-Fmoc-5-fluoro-L-tryptophan structure
|
Common Name | N-Fmoc-5-fluoro-L-tryptophan | ||
|---|---|---|---|---|
| CAS Number | 908846-88-8 | Molecular Weight | 444.454 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 713.9±60.0 °C at 760 mmHg | |
| Molecular Formula | C26H21FN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 385.6±32.9 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-fluoro-1H-indol-3-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 713.9±60.0 °C at 760 mmHg |
| Molecular Formula | C26H21FN2O4 |
| Molecular Weight | 444.454 |
| Flash Point | 385.6±32.9 °C |
| Exact Mass | 444.148529 |
| PSA | 94.91000 |
| LogP | 5.47 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.678 |
| InChIKey | GIFXTRKMFUWKHR-DEOSSOPVSA-N |
| SMILES | O=C(NC(Cc1c[nH]c2ccc(F)cc12)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | 2-8°C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~94%
N-Fmoc-5-fluoro... CAS#:908846-88-8 |
| Literature: Blaser, Georg; Sanderson, John M.; Batsanov, Andrei S.; Howard, Judith A.K. Tetrahedron Letters, 2008 , vol. 49, # 17 p. 2795 - 2798 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Fmoc-5-fluoro-L-tryptophan |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-5-fluoro-L-tryptophan |
| SC1112 |
| N-Fmoc-5-fluoro-L-tryptophan |
| Fmoc-Trp(5-F)-OH |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-fluoro-1H-indol-3-yl)propanoic acid? |
| A: LogP of (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-fluoro-1H-indol-3-yl)propanoic acid is 5.47. |
| Q: What are the storage conditions for (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-fluoro-1H-indol-3-yl)propanoic acid? |
| A: Storage conditions for (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-fluoro-1H-indol-3-yl)propanoic acid: 2-8°C. |
| Q: What is the molecular formula of (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-fluoro-1H-indol-3-yl)propanoic acid? |
| A: Molecular formula of (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-fluoro-1H-indol-3-yl)propanoic acid is C26H21FN2O4. |
| Q: What is the boiling point of (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-fluoro-1H-indol-3-yl)propanoic acid? |
| A: Boiling point of (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-fluoro-1H-indol-3-yl)propanoic acid is 713.9±60.0 °C at 760 mmHg. |
| Q: What is the InChIKey of (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-fluoro-1H-indol-3-yl)propanoic acid? |
| A: InChIKey of (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-fluoro-1H-indol-3-yl)propanoic acid is GIFXTRKMFUWKHR-DEOSSOPVSA-N. |
| Q: What is the molecular weight of (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-fluoro-1H-indol-3-yl)propanoic acid? |
| A: Molecular weight of (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-fluoro-1H-indol-3-yl)propanoic acid is 444.454. |
| Q: What is the polar surface area (PSA) of (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-fluoro-1H-indol-3-yl)propanoic acid? |
| A: Polar surface area (PSA) of (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-fluoro-1H-indol-3-yl)propanoic acid is 94.91000. |
| Q: What are the upstream materials of (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-fluoro-1H-indol-3-yl)propanoic acid? |
| A: Related upstream materials(CAS) of (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-fluoro-1H-indol-3-yl)propanoic acid: 102774-86-7;16626-02-1. |
| Q: What is the English name of (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-fluoro-1H-indol-3-yl)propanoic acid? |
| A: The English name of (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-fluoro-1H-indol-3-yl)propanoic acid is (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-fluoro-1H-indol-3-yl)propanoic acid. |
| Q: What is the CAS number of (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-fluoro-1H-indol-3-yl)propanoic acid? |
| A: CAS number of (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-fluoro-1H-indol-3-yl)propanoic acid is 908846-88-8. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |