Fluorobis(phenylsulfonyl)methane
Fluorobis(phenylsulfonyl)methane structure
|
Common Name | Fluorobis(phenylsulfonyl)methane | ||
|---|---|---|---|---|
| CAS Number | 910650-82-7 | Molecular Weight | 314.35200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11FO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Fluorobis(phenylsulfonyl)methane, also known as fluorobis(phenylsulfonyl) methane, CAS号910650-82-7, molecular formula C13H11FO4S2, molecular weight 314.35200, for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Fluorobis(phenylsulfonyl)methane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H11FO4S2 |
|---|---|
| Molecular Weight | 314.35200 |
| Exact Mass | 314.00800 |
| PSA | 85.04000 |
| LogP | 4.34890 |
| InChIKey | TUZGMBZILYZZRU-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)C(F)S(=O)(=O)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![[fluoro(phenylsulfinyl)methylsulfonyl]benzene structure](https://image.chemsrc.com/caspic/219/1151549-59-5.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 3 | |
CAS#:1203825-68-6
CAS#:104-55-2
CAS#:66-99-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| BIS(PHENYLSULPHONYL)METHANE |
| (PhSO2)2CH2 |
| METHYLENEBIS(PHENYL SULFONE) |
| CHF(SO2Ph)2 |
| (Methylenedisulfonyl)dibenzene |
| bis-phenylsulfonyl methane |
| Bis(benzenesulfonyl)methane |
| Di(phenylsulfonyl)methane |
| Bis-(phenylsulfonyl)-methan |
| bis(benzenesulfonyl)fluoromethane |
| (PhSO2)2CHF |
| CH2(SO2Ph)2 |
| bis(phenylsulfonyl)methaneyl-1,3-butadiene |
| 1-(fluoro(phenylsulfonyl)methylsulfonyl)benzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Fluorobis(phenylsulfonyl)methane? |
| A: SMILES notation of Fluorobis(phenylsulfonyl)methane is O=S(=O)(c1ccccc1)C(F)S(=O)(=O)c1ccccc1. |
| Q: What is the molecular weight of Fluorobis(phenylsulfonyl)methane? |
| A: Molecular weight of Fluorobis(phenylsulfonyl)methane is 314.35200. |
| Q: What is the English name of Fluorobis(phenylsulfonyl)methane? |
| A: The English name of Fluorobis(phenylsulfonyl)methane is Fluorobis(phenylsulfonyl)methane. |
| Q: What is the polar surface area (PSA) of Fluorobis(phenylsulfonyl)methane? |
| A: Polar surface area (PSA) of Fluorobis(phenylsulfonyl)methane is 85.04000. |
| Q: What is the CAS number of Fluorobis(phenylsulfonyl)methane? |
| A: CAS number of Fluorobis(phenylsulfonyl)methane is 910650-82-7. |
| Q: What are the upstream materials of Fluorobis(phenylsulfonyl)methane? |
| A: Related upstream materials(CAS) of Fluorobis(phenylsulfonyl)methane: 3406-02-8;1151549-59-5;1061868-34-5;20808-12-2;368-43-4;98-09-9;100-68-5;7205-91-6;60839-94-3. |
| Q: What is the LogP of Fluorobis(phenylsulfonyl)methane? |
| A: LogP of Fluorobis(phenylsulfonyl)methane is 4.34890. |
| Q: What are the downstream products of Fluorobis(phenylsulfonyl)methane? |
| A: Related downstream products(CAS) of Fluorobis(phenylsulfonyl)methane: 1203825-68-6;104-55-2;66-99-9. |
| Q: What is the InChIKey of Fluorobis(phenylsulfonyl)methane? |
| A: InChIKey of Fluorobis(phenylsulfonyl)methane is TUZGMBZILYZZRU-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Fluorobis(phenylsulfonyl)methane? |
| A: Molecular formula of Fluorobis(phenylsulfonyl)methane is C13H11FO4S2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |