5-Bromo-4-[2-(Dimethylamino)Ethenyl]-2-Methoxy-3-Nitropyridine
![5-Bromo-4-[2-(Dimethylamino)Ethenyl]-2-Methoxy-3-Nitropyridine Structure](https://image.chemsrc.com/caspic/257/917918-81-1.png)
5-Bromo-4-[2-(Dimethylamino)Ethenyl]-2-Methoxy-3-Nitropyridine structure
|
Common Name | 5-Bromo-4-[2-(Dimethylamino)Ethenyl]-2-Methoxy-3-Nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 917918-81-1 | Molecular Weight | 302.12500 | |
| Density | 1.514±0.06 g/cm3 (20 °C, 760 mmHg) | Boiling Point | 392.2±42.0 °C (760 mmHg) | |
| Molecular Formula | C10H12BrN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.514±0.06 g/cm3 (20 °C, 760 mmHg) |
|---|---|
| Boiling Point | 392.2±42.0 °C (760 mmHg) |
| Molecular Formula | C10H12BrN3O3 |
| Molecular Weight | 302.12500 |
| Exact Mass | 301.00600 |
| PSA | 71.18000 |
| LogP | 2.81640 |
| InChIKey | BNKMXMCVPWPRMR-SNAWJCMRSA-N |
| SMILES | COc1ncc(Br)c(C=CN(C)C)c1[N+](=O)[O-] |
| Storage condition | 2-8°C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
![4,7-Dimethoxy-1H-pyrrolo[2,3-c]pyridine structure](https://image.chemsrc.com/caspic/162/452296-79-6.png)
CAS#:452296-79-6![1-{4-methoxy-1H-pyrrolo[2,3-c]pyridin-7-yl}-3-methyl-1H-1,2,4-triazole structure](https://image.chemsrc.com/caspic/333/676491-46-6.png)
CAS#:676491-46-6
CAS#:917918-82-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-BroMo-4-[2-(diMethylaMino)ethenyl]-2-Methoxy-3-nitropyridine-4 |
| 5-Bromo-4-[2-(dimethylamino)ethenyl]-2-methoxy-3-nitropyridine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl? |
| A: Polar surface area (PSA) of Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl is 71.18000. |
| Q: What are the downstream products of Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl? |
| A: Related downstream products(CAS) of Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl: 452296-79-6;676491-46-6;917918-82-2. |
| Q: What is the CAS number of Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl? |
| A: CAS number of Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl is 917918-81-1. |
| Q: What is the molecular weight of Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl? |
| A: Molecular weight of Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl is 302.12500. |
| Q: What is the LogP of Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl? |
| A: LogP of Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl is 2.81640. |
| Q: What is the SMILES notation of Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl? |
| A: SMILES notation of Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl is COc1ncc(Br)c(C=CN(C)C)c1[N+](=O)[O-]. |
| Q: What is the molecular formula of Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl? |
| A: Molecular formula of Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl is C10H12BrN3O3. |
| Q: What are the storage conditions for Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl? |
| A: Storage conditions for Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl: 2-8°C. |
| Q: What English synonyms does Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl have? |
| A: English synonyms of Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl: 5-BroMo-4-[2-(diMethylaMino)ethenyl]-2-Methoxy-3-nitropyridine-4, 5-Bromo-4-[2-(dimethylamino)ethenyl]-2-methoxy-3-nitropyridine. |
| Q: What is the English name of Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl? |
| A: The English name of Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl is Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |