methyl 2,4,5-triamino-3-fluorobenzoate
methyl 2,4,5-triamino-3-fluorobenzoate structure
|
Common Name | methyl 2,4,5-triamino-3-fluorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 918321-27-4 | Molecular Weight | 199.18200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10FN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 2,4,5-triamino-3-fluorobenzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H10FN3O2 |
|---|---|
| Molecular Weight | 199.18200 |
| Exact Mass | 199.07600 |
| PSA | 104.36000 |
| LogP | 2.10250 |
| InChIKey | RADQVYGLIBGGAP-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(N)c(N)c(F)c1N |
| Storage condition | 2-8℃ |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~99%
methyl 2,4,5-tr... CAS#:918321-27-4 |
| Literature: ARRAY BIOPHARMA INC.; ASTRAZENECA AB Patent: WO2007/2157 A2, 2007 ; Location in patent: Page/Page column 73 ; WO 2007/002157 A2 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzoic acid,2,4,5-triamino-3-fluoro-,methyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of methyl 2,4,5-triamino-3-fluorobenzoate? |
| A: SMILES notation of methyl 2,4,5-triamino-3-fluorobenzoate is COC(=O)c1cc(N)c(N)c(F)c1N. |
| Q: What is the LogP of methyl 2,4,5-triamino-3-fluorobenzoate? |
| A: LogP of methyl 2,4,5-triamino-3-fluorobenzoate is 2.10250. |
| Q: What is the molecular weight of methyl 2,4,5-triamino-3-fluorobenzoate? |
| A: Molecular weight of methyl 2,4,5-triamino-3-fluorobenzoate is 199.18200. |
| Q: What is the CAS number of methyl 2,4,5-triamino-3-fluorobenzoate? |
| A: CAS number of methyl 2,4,5-triamino-3-fluorobenzoate is 918321-27-4. |
| Q: What is the English name of methyl 2,4,5-triamino-3-fluorobenzoate? |
| A: The English name of methyl 2,4,5-triamino-3-fluorobenzoate is methyl 2,4,5-triamino-3-fluorobenzoate. |
| Q: What English synonyms does methyl 2,4,5-triamino-3-fluorobenzoate have? |
| A: English synonyms of methyl 2,4,5-triamino-3-fluorobenzoate: Benzoic acid,2,4,5-triamino-3-fluoro-,methyl ester. |
| Q: What are the storage conditions for methyl 2,4,5-triamino-3-fluorobenzoate? |
| A: Storage conditions for methyl 2,4,5-triamino-3-fluorobenzoate: 2-8℃. |
| Q: What is the polar surface area (PSA) of methyl 2,4,5-triamino-3-fluorobenzoate? |
| A: Polar surface area (PSA) of methyl 2,4,5-triamino-3-fluorobenzoate is 104.36000. |
| Q: What is the InChIKey of methyl 2,4,5-triamino-3-fluorobenzoate? |
| A: InChIKey of methyl 2,4,5-triamino-3-fluorobenzoate is RADQVYGLIBGGAP-UHFFFAOYSA-N. |
| Q: What is the molecular formula of methyl 2,4,5-triamino-3-fluorobenzoate? |
| A: Molecular formula of methyl 2,4,5-triamino-3-fluorobenzoate is C8H10FN3O2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |