4-chloro-1-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine
![4-chloro-1-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine Structure](https://image.chemsrc.com/caspic/044/924909-17-1.png)
4-chloro-1-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine structure
|
Common Name | 4-chloro-1-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine | ||
|---|---|---|---|---|
| CAS Number | 924909-17-1 | Molecular Weight | 273.71800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-chloro-1-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H12ClN3O |
|---|---|
| Molecular Weight | 273.71800 |
| Exact Mass | 273.06700 |
| PSA | 39.94000 |
| LogP | 3.14160 |
| InChIKey | HLSOCIKLODRQFV-UHFFFAOYSA-N |
| SMILES | COc1ccc(Cn2ncc3c(Cl)ccnc32)cc1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-chloro-1H-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4-chloro-1-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine? |
| A: SMILES notation of 4-chloro-1-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine is COc1ccc(Cn2ncc3c(Cl)ccnc32)cc1. |
| Q: What is the LogP of 4-chloro-1-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine? |
| A: LogP of 4-chloro-1-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine is 3.14160. |
| Q: What is the molecular formula of 4-chloro-1-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine? |
| A: Molecular formula of 4-chloro-1-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine is C14H12ClN3O. |
| Q: What is the molecular weight of 4-chloro-1-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine? |
| A: Molecular weight of 4-chloro-1-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine is 273.71800. |
| Q: What is the English name of 4-chloro-1-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine? |
| A: The English name of 4-chloro-1-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine is 4-chloro-1-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine. |
| Q: What English synonyms does 4-chloro-1-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine have? |
| A: English synonyms of 4-chloro-1-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine: 4-chloro-1H-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine. |
| Q: What is the InChIKey of 4-chloro-1-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine? |
| A: InChIKey of 4-chloro-1-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine is HLSOCIKLODRQFV-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-chloro-1-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine? |
| A: CAS number of 4-chloro-1-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine is 924909-17-1. |
| Q: What is the polar surface area (PSA) of 4-chloro-1-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine? |
| A: Polar surface area (PSA) of 4-chloro-1-(4-methoxybenzyl)-1H-pyrazolo[3,4-b]pyridine is 39.94000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |