4-Bromo-2,6-dinitrobenzoic acid
4-Bromo-2,6-dinitrobenzoic acid structure
|
Common Name | 4-Bromo-2,6-dinitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 95192-56-6 | Molecular Weight | 291.01300 | |
| Density | 2.051g/cm3 | Boiling Point | 406.9ºC at 760mmHg | |
| Molecular Formula | C7H3BrN2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Bromo-2,6-dinitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 2.051g/cm3 |
|---|---|
| Boiling Point | 406.9ºC at 760mmHg |
| Molecular Formula | C7H3BrN2O6 |
| Molecular Weight | 291.01300 |
| Flash Point | 199.9ºC |
| Exact Mass | 289.91700 |
| PSA | 128.94000 |
| LogP | 3.01010 |
| Index of Refraction | 1.685 |
| InChIKey | AGYWRQRLPWSJLO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c([N+](=O)[O-])cc(Br)cc1[N+](=O)[O-] |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2916399090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-Bromo-2,6-din... CAS#:95192-56-6 |
| Literature: Journal of Organic Chemistry, , vol. 50, # 7 p. 1041 - 1045 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:18242-39-2This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Bromo-2,6-dinitrobenzoicAcid |
| 4-bromanyl-2,6-dinitro-benzoic acid |
| 2,6-DINITRO-4-BROMOBENZOIC ACID |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-Bromo-2,6-dinitrobenzoic acid? |
| A: Molecular weight of 4-Bromo-2,6-dinitrobenzoic acid is 291.01300. |
| Q: What is the SMILES notation of 4-Bromo-2,6-dinitrobenzoic acid? |
| A: SMILES notation of 4-Bromo-2,6-dinitrobenzoic acid is O=C(O)c1c([N+](=O)[O-])cc(Br)cc1[N+](=O)[O-]. |
| Q: What English synonyms does 4-Bromo-2,6-dinitrobenzoic acid have? |
| A: English synonyms of 4-Bromo-2,6-dinitrobenzoic acid: 4-Bromo-2,6-dinitrobenzoicAcid, 4-bromanyl-2,6-dinitro-benzoic acid, 2,6-DINITRO-4-BROMOBENZOIC ACID. |
| Q: What is the CAS number of 4-Bromo-2,6-dinitrobenzoic acid? |
| A: CAS number of 4-Bromo-2,6-dinitrobenzoic acid is 95192-56-6. |
| Q: What is the English name of 4-Bromo-2,6-dinitrobenzoic acid? |
| A: The English name of 4-Bromo-2,6-dinitrobenzoic acid is 4-Bromo-2,6-dinitrobenzoic acid. |
| Q: What is the InChIKey of 4-Bromo-2,6-dinitrobenzoic acid? |
| A: InChIKey of 4-Bromo-2,6-dinitrobenzoic acid is AGYWRQRLPWSJLO-UHFFFAOYSA-N. |
| Q: What is the LogP of 4-Bromo-2,6-dinitrobenzoic acid? |
| A: LogP of 4-Bromo-2,6-dinitrobenzoic acid is 3.01010. |
| Q: What is the boiling point of 4-Bromo-2,6-dinitrobenzoic acid? |
| A: Boiling point of 4-Bromo-2,6-dinitrobenzoic acid is 406.9ºC at 760mmHg. |
| Q: What is the polar surface area (PSA) of 4-Bromo-2,6-dinitrobenzoic acid? |
| A: Polar surface area (PSA) of 4-Bromo-2,6-dinitrobenzoic acid is 128.94000. |
| Q: What are the upstream materials of 4-Bromo-2,6-dinitrobenzoic acid? |
| A: Related upstream materials(CAS) of 4-Bromo-2,6-dinitrobenzoic acid: 95192-64-6. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |