4-O-Coumaroylquinic acid
Modify Date: 2025-08-25 12:16:29
4-O-Coumaroylquinic acid structure
|
Common Name | 4-O-Coumaroylquinic acid | ||
|---|---|---|---|---|
| CAS Number | 53539-37-0 | Molecular Weight | 338.1 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 4-O-Coumaroylquinic acid4-O-Coumaroylquinic acid has potential inhibitory capacity on the spike glycoprotein trimer of SARS-CoV-2.4-O-Coumaroylquinic acid has inhibitory activity against LdNH.4-O-Coumaroylquinic acid has certain antioxidant capacity. |
| Name | 4-O-Coumaroylquinic acid |
|---|
| Molecular Formula | C16H18O8 |
|---|---|
| Molecular Weight | 338.1 |
| Appearance of Characters | Powder |
| InChIKey | XWRHBGVVCOSNKO-LGTQLRDQSA-N |
| SMILES | O=C(C=Cc1ccc(O)cc1)OC1C(O)CC(O)(C(=O)O)CC1O |