2-Amino-4,5-bis(2-methoxyethoxy)benzoic acid ethyl ester hydrochloride structure
|
Common Name | 2-Amino-4,5-bis(2-methoxyethoxy)benzoic acid ethyl ester hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 183322-17-0 | Molecular Weight | 349.807 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24ClNO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H24ClNO6 |
|---|---|
| Molecular Weight | 349.807 |
| Exact Mass | 349.129211 |
| PSA | 89.24000 |
| LogP | 2.87910 |
| InChIKey | CVAXGYHQKOQSDV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(OCCOC)c(OCCOC)cc1N.Cl |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Ethyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate hydrochloride |
| 2-Amino-4,5-bis(2-methoxyethoxy)benzoicacidethylesterhydrochloride |
| Ethyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate hydrochloride (1:1) |
| Benzoic acid, 2-amino-4,5-bis(2-methoxyethoxy)-, ethyl ester, hydrochloride (1:1) |
| Erlotinib Intermediate IV |
| 2-Amino-4,5-bis(2-methoxyethoxy)benzoic acid ethyl ester hydrochloride |