((R)-3-Methyl-1-((R)-3-phenyl-2-(pyrazine-2-carboxamido)propanamido)butyl)boronic acid
Modify Date: 2025-09-11 17:15:02
((R)-3-Methyl-1-((R)-3-phenyl-2-(pyrazine-2-carboxamido)propanamido)butyl)boronic acid structure
|
Common Name | ((R)-3-Methyl-1-((R)-3-phenyl-2-(pyrazine-2-carboxamido)propanamido)butyl)boronic acid | ||
|---|---|---|---|---|
| CAS Number | 1132709-15-9 | Molecular Weight | 384.237 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C19H25BN4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(1R)-3-methyl-1-[[(2R)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Molecular Formula | C19H25BN4O4 |
| Molecular Weight | 384.237 |
| Exact Mass | 384.196899 |
| PSA | 131.42000 |
| LogP | 2.45 |
| Index of Refraction | 1.564 |
| InChIKey | GXJABQQUPOEUTA-WBVHZDCISA-N |
| SMILES | CC(C)CC(NC(=O)C(Cc1ccccc1)NC(=O)c1cnccn1)B(O)O |
| HS Code | 2934999090 |
|---|
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Inhibition of LONP1 (unknown origin) using QXL520-YRGITCSGRQK(5-FAM)-NH2 peptide as s...
Source: ChEMBL
Target: Lon protease homolog, mitochondrial
External Id: CHEMBL4823871
|
|
Name: Inhibition of human erythrocytes 20S proteasome using QXL520-YRGITCSGRQK(5-FAM)-NH2 f...
Source: ChEMBL
Target: Proteasome subunit beta type-8
External Id: CHEMBL4823872
|
Total 2, Current Page 1 of 1
1
| ((R)-3-Methyl-1-((R)-3-phenyl-2-(pyrazine-2-carboxamido)propanamido)butyl)boronic acid |
| (1R,2R)-Bortezomib |
| N-[(1R)-1-(Dihydroxyboryl)-3-methylbutyl]-Nα-(2-pyrazinylcarbonyl)-D-phenylalaninamide |