Methyl-2-bromo-3-{4-[2-(5-ethyl-2-pyridyl)ethoxy]phenyl} propionate structure
|
Common Name | Methyl-2-bromo-3-{4-[2-(5-ethyl-2-pyridyl)ethoxy]phenyl} propionate | ||
|---|---|---|---|---|
| CAS Number | 105355-25-7 | Molecular Weight | 392.287 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 485.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C19H22BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.1±28.7 °C | |
| Name | methyl 2-bromo-3-[4-[2-(5-ethylpyridin-2-yl)ethoxy]phenyl]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 485.0±45.0 °C at 760 mmHg |
| Molecular Formula | C19H22BrNO3 |
| Molecular Weight | 392.287 |
| Flash Point | 247.1±28.7 °C |
| Exact Mass | 391.078308 |
| PSA | 48.42000 |
| LogP | 4.05 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | CJQRUDWOZDEKKO-UHFFFAOYSA-N |
| SMILES | CCc1ccc(CCOc2ccc(CC(Br)C(=O)OC)cc2)nc1 |
| HS Code | 2933399090 |
|---|
|
~%
Methyl-2-bromo-... CAS#:105355-25-7 |
| Literature: WO2006/117654 A1, ; Page/Page column 9-14 ; |
|
~%
Methyl-2-bromo-... CAS#:105355-25-7 |
| Literature: Arzneimittel-Forschung/Drug Research, , vol. 40, # 1 p. 37 - 42 |
|
~%
Methyl-2-bromo-... CAS#:105355-25-7 |
| Literature: Arzneimittel-Forschung/Drug Research, , vol. 40, # 1 p. 37 - 42 |
|
~%
Methyl-2-bromo-... CAS#:105355-25-7 |
| Literature: Arzneimittel-Forschung/Drug Research, , vol. 40, # 1 p. 37 - 42 |
|
~%
Methyl-2-bromo-... CAS#:105355-25-7 |
| Literature: Arzneimittel-Forschung/Drug Research, , vol. 40, # 1 p. 37 - 42 |
| Precursor 5 | |
|---|---|
| DownStream 4 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzenepropanoic acid, α-bromo-4-[2-(5-ethyl-2-pyridinyl)ethoxy]-, methyl ester |
| Methyl 2-bromo-3-{4-[2-(5-ethylpyridin-2-yl)ethoxy]phenyl}propanoate |
| 2-bromo-3-(4-(2-(5-ethyl-2-pyridyl)ethoxy)phenyl)propionic acid methyl ester |
| pioglitazone bromo ether |
| Methyl 2-bromo-3-[4-[2-(5-ethyl-2-pyridyl)ethoxy]phenyl]propionate |
| methyl 2-bromo-3-{4-[2-(5-ethyl-pyridin-2-yl)ethoxy]phenyl}propionate |
| Methyl 2-bromo-3-{4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl}propanoate |
| methyl 2-bromo-3-(4-(2-(5-ethylpyridin-2-yl)ethoxy)phenyl)propanoate |