Magnesium glycinate structure
|
Common Name | Magnesium glycinate | ||
|---|---|---|---|---|
| CAS Number | 14783-68-7 | Molecular Weight | 172.422 | |
| Density | N/A | Boiling Point | 240.9ºC at 760 mmHg | |
| Molecular Formula | C4H8MgN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Magnesium glycinateMagnesium glycinate, a nutrient supplement, has satisfactory physico-chemical properties and bioactivities. Metal glycinate chelates are formed by glycine and metal compounds through chemical reactions. Magnesium is an essential mineral that plays a critical role in the human body. Magnesium takes part in the process of energy metabolism and assists the maintenance of normal muscle function[1][2]. |
| Name | Magnesium 2-aminoacetate |
|---|---|
| Synonym | More Synonyms |
| Description | Magnesium glycinate, a nutrient supplement, has satisfactory physico-chemical properties and bioactivities. Metal glycinate chelates are formed by glycine and metal compounds through chemical reactions. Magnesium is an essential mineral that plays a critical role in the human body. Magnesium takes part in the process of energy metabolism and assists the maintenance of normal muscle function[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Calcium glycinate, magnesium glycinate and zinc glycinate are kinds of new-type and ideal nutrient supplements, which have satisfactory physico-chemical properties and bioactivities. They are important for prophylaxis and treat metal deficiency[1]. |
| References |
| Boiling Point | 240.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C4H8MgN2O4 |
| Molecular Weight | 172.422 |
| Exact Mass | 172.033447 |
| PSA | 132.30000 |
| Vapour Pressure | 0.0123mmHg at 25°C |
| InChIKey | AACACXATQSKRQG-UHFFFAOYSA-L |
| SMILES | NCC(=O)[O-].NCC(=O)[O-].[Mg+2] |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2922499990 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Magnesium bisglycinate |
| magnesium,2-aminoacetate |
| Glycine, magnesium salt (2:1) |
| Magnesium bis(aminoacetate) |
| magnesium diglycinate |