2-(Bis(2-hydroxyethyl)amino)ethyl oleate
2-(Bis(2-hydroxyethyl)amino)ethyl oleate structure
|
Common Name | 2-(Bis(2-hydroxyethyl)amino)ethyl oleate | ||
|---|---|---|---|---|
| CAS Number | 10277-04-0 | Molecular Weight | 413.634 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 528.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C24H47NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.6±27.3 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[bis(2-hydroxyethyl)amino]ethyl (Z)-octadec-9-enoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 528.7±40.0 °C at 760 mmHg |
| Molecular Formula | C24H47NO4 |
| Molecular Weight | 413.634 |
| Flash Point | 273.6±27.3 °C |
| Exact Mass | 413.350494 |
| PSA | 70.00000 |
| LogP | 7.53 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Index of Refraction | 1.487 |
| InChIKey | FTJUZCBLWZLXFR-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCCN(CCO)CCO |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2916150000 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| EINECS 233-621-2 |
| triethanolamine monooleate ester |
| 9-Octadecenoic acid (9Z)-,2-(bis(2-hydroxyethyl)amino)ethyl ester |
| 2-[Bis(2-hydroxyethyl)amino]ethyl (9Z)-9-octadecenoate |
| Triethanolamine,oleic acid monoester |
| 2-(Bis(2-hydroxyethyl)amino)ethyl oleate |
| 9-Octadecenoic acid,(Z)-,2-(bis(2-hydroxyethyl)amino)ethyl ester |
| 2-[Bis(2-hydroxyethyl)amino]ethyl (9Z)-octadec-9-enoate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-[bis(2-hydroxyethyl)amino]ethyl (Z)-octadec-9-enoate? |
| A: The English name of 2-[bis(2-hydroxyethyl)amino]ethyl (Z)-octadec-9-enoate is 2-[bis(2-hydroxyethyl)amino]ethyl (Z)-octadec-9-enoate. |
| Q: What is the InChIKey of 2-[bis(2-hydroxyethyl)amino]ethyl (Z)-octadec-9-enoate? |
| A: InChIKey of 2-[bis(2-hydroxyethyl)amino]ethyl (Z)-octadec-9-enoate is FTJUZCBLWZLXFR-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-[bis(2-hydroxyethyl)amino]ethyl (Z)-octadec-9-enoate? |
| A: CAS number of 2-[bis(2-hydroxyethyl)amino]ethyl (Z)-octadec-9-enoate is 10277-04-0. |
| Q: What is the molecular formula of 2-[bis(2-hydroxyethyl)amino]ethyl (Z)-octadec-9-enoate? |
| A: Molecular formula of 2-[bis(2-hydroxyethyl)amino]ethyl (Z)-octadec-9-enoate is C24H47NO4. |
| Q: What is the polar surface area (PSA) of 2-[bis(2-hydroxyethyl)amino]ethyl (Z)-octadec-9-enoate? |
| A: Polar surface area (PSA) of 2-[bis(2-hydroxyethyl)amino]ethyl (Z)-octadec-9-enoate is 70.00000. |
| Q: What English synonyms does 2-[bis(2-hydroxyethyl)amino]ethyl (Z)-octadec-9-enoate have? |
| A: English synonyms of 2-[bis(2-hydroxyethyl)amino]ethyl (Z)-octadec-9-enoate: EINECS 233-621-2, triethanolamine monooleate ester, 9-Octadecenoic acid (9Z)-,2-(bis(2-hydroxyethyl)amino)ethyl ester, 2-[Bis(2-hydroxyethyl)amino]ethyl (9Z)-9-octadecenoate, Triethanolamine,oleic acid monoester, 2-(Bis(2-hydroxyethyl)amino)ethyl oleate, 9-Octadecenoic acid,(Z)-,2-(bis(2-hydroxyethyl)amino)ethyl ester, 2-[Bis(2-hydroxyethyl)amino]ethyl (9Z)-octadec-9-enoate. |
| Q: What is the SMILES notation of 2-[bis(2-hydroxyethyl)amino]ethyl (Z)-octadec-9-enoate? |
| A: SMILES notation of 2-[bis(2-hydroxyethyl)amino]ethyl (Z)-octadec-9-enoate is CCCCCCCCC=CCCCCCCCC(=O)OCCN(CCO)CCO. |
| Q: What is the boiling point of 2-[bis(2-hydroxyethyl)amino]ethyl (Z)-octadec-9-enoate? |
| A: Boiling point of 2-[bis(2-hydroxyethyl)amino]ethyl (Z)-octadec-9-enoate is 528.7±40.0 °C at 760 mmHg. |
| Q: What is the molecular weight of 2-[bis(2-hydroxyethyl)amino]ethyl (Z)-octadec-9-enoate? |
| A: Molecular weight of 2-[bis(2-hydroxyethyl)amino]ethyl (Z)-octadec-9-enoate is 413.634. |
| Q: What is the LogP of 2-[bis(2-hydroxyethyl)amino]ethyl (Z)-octadec-9-enoate? |
| A: LogP of 2-[bis(2-hydroxyethyl)amino]ethyl (Z)-octadec-9-enoate is 7.53. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |