2-Boc-2,8-Diazaspiro[4.5]decane structure
|
Common Name | 2-Boc-2,8-Diazaspiro[4.5]decane | ||
|---|---|---|---|---|
| CAS Number | 336191-17-4 | Molecular Weight | 240.342 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 337.0±35.0 °C at 760 mmHg | |
| Molecular Formula | C13H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.6±25.9 °C | |
| Name | tert-Butyl 2,8-diazaspiro[4.5]decane-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 337.0±35.0 °C at 760 mmHg |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.342 |
| Flash Point | 157.6±25.9 °C |
| Exact Mass | 240.183777 |
| PSA | 41.57000 |
| LogP | 1.46 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | NFNCPNAVNRBDOU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCNCC2)C1 |
| HS Code | 2933990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,1-Dimethylethyl 2,8-diazaspiro[4.5]decane-2-carboxylate |
| 2-Boc-2,8-Diazaspiro[4.5]decane |
| 2-Methyl-2-propanyl 2,8-diazaspiro[4.5]decane-2-carboxylate |
| 2,8-Diazaspiro[4.5]decane-2-carboxylic acid, 1,1-dimethylethyl ester |
| tert-Butyl 2,8-diazaspiro[4.5]decane-2-carboxylate |
| T6M DXTJ D-& CT5N CXTJ AVOX1&1&1 |