HA-15 structure
|
Common Name | HA-15 | ||
|---|---|---|---|---|
| CAS Number | 1609402-14-3 | Molecular Weight | 466.576 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C23H22N4O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of HA-15HA15 is a molecule that targets specifically BiP/GRP78/HSPA5target: BiP, GRP78, HSPA5 [1]In vitro: HA15 induces ER stress leading to cancer cell death. kills cancer cells by targeting BiP to increase ER stress, leading to melanoma cell death by concomitant induction of autophagic and apoptotic mechanisms. HA15 exhibits strong efficacy in melanoma cells. The 50% inhibitory concentration (IC50) in A375 cells was between 1 and 2.5 mM HA15. [1]In vivo: HA15 induces ER stress leading to cancer cell death. HA15 also exhibited strong efficacy in xenograft mouse models with melanoma cellseither sensitive or resistant to BRAF inhibitors. [1] |
| Name | HA15 |
|---|---|
| Synonym | More Synonyms |
| Description | HA15 is a molecule that targets specifically BiP/GRP78/HSPA5target: BiP, GRP78, HSPA5 [1]In vitro: HA15 induces ER stress leading to cancer cell death. kills cancer cells by targeting BiP to increase ER stress, leading to melanoma cell death by concomitant induction of autophagic and apoptotic mechanisms. HA15 exhibits strong efficacy in melanoma cells. The 50% inhibitory concentration (IC50) in A375 cells was between 1 and 2.5 mM HA15. [1]In vivo: HA15 induces ER stress leading to cancer cell death. HA15 also exhibited strong efficacy in xenograft mouse models with melanoma cellseither sensitive or resistant to BRAF inhibitors. [1] |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C23H22N4O3S2 |
| Molecular Weight | 466.576 |
| Exact Mass | 466.113342 |
| LogP | 4.56 |
| Index of Refraction | 1.701 |
| InChIKey | LBSMEKVVMYSTIH-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1nc(-c2cccc(NS(=O)(=O)c3cccc4c(N(C)C)cccc34)c2)cs1 |
| Storage condition | -20℃ |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| N-{4-[3-({[5-(Dimethylamino)-1-naphthyl]sulfonyl}amino)phenyl]-1,3-thiazol-2-yl}acetamide |
| HA15 |
| HA-15 |