N-(4-Aminophenyl)-N,4-dimethyl-1-piperazineacetamide structure
|
Common Name | N-(4-Aminophenyl)-N,4-dimethyl-1-piperazineacetamide | ||
|---|---|---|---|---|
| CAS Number | 262368-30-9 | Molecular Weight | 262.351 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 434.8±40.0 °C at 760 mmHg | |
| Molecular Formula | C14H22N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.7±27.3 °C | |
| Name | N-(4-aminophenyl)-N-methyl-2-(4-methylpiperazin-1-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 434.8±40.0 °C at 760 mmHg |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.351 |
| Flash Point | 216.7±27.3 °C |
| Exact Mass | 262.179352 |
| PSA | 52.81000 |
| LogP | -0.86 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | LBWNQLVDYPNHAV-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC(=O)N(C)c2ccc(N)cc2)CC1 |
| HS Code | 2933599090 |
|---|
|
~70%
N-(4-Aminopheny... CAS#:262368-30-9 |
| Literature: WO2012/68441 A2, ; Page/Page column 13; 14 ; |
|
~80%
N-(4-Aminopheny... CAS#:262368-30-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 52, # 14 p. 4466 - 4480 |
|
~%
N-(4-Aminopheny... CAS#:262368-30-9 |
| Literature: WO2012/68441 A2, ; |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-(4-Aminophenyl)-N,4-dimethyl-1-piperazineacetamide |
| N-[(4-methyl-piperazin-1-yl)-methylcarbonyl]-N-methyl-p-phenyldiamine |
| N-[(4-methyl-piperazin-1-yl)-methylcarbonyl]-N-methyl-p-phenylenediamine |
| N-(4-Aminophenyl)-N-methyl-2-(4-methyl-1-piperazinyl)acetamide |
| N-[(4-methyl-piperazin-1-yl)-methylcarbonyl]-N-methyl-p-phenylendiamine |